C17H32O2 — CID 22856032
(2S,3R,4S,5S)-4-methoxy-3,5-dimethyl-2-[(E)-non-1-enyl]oxane (PubChem CID 22856032) has the molecular formula C17H32O2 and a molecular weight of 268.44 g/mol. Its IUPAC name is (2S,3R,4S,5S)-4-methoxy-3,5-dimethyl-2-[(E)-non-1-enyl]oxane.
| Compound Name | (2S,3R,4S,5S)-4-methoxy-3,5-dimethyl-2-[(E)-non-1-enyl]oxane |
|---|---|
| PubChem CID | 22856032 |
| Molecular Formula | C17H32O2 |
| Molecular Weight | 268.44 g/mol |
| Exact Mass | 268.24 |
| IUPAC Name | (2S,3R,4S,5S)-4-methoxy-3,5-dimethyl-2-[(E)-non-1-enyl]oxane |
| SMILES | CCCCCCC/C=C/[C@@H]1OC[C@H](C)[C@H](OC)[C@H]1C |
| InChI | InChI=1S/C17H32O2/c1-5-6-7-8-9-10-11-12-16-15(3)17(18-4)14(2)13-19-16/h11-12,14-17H,5-10,13H2,1-4H3/b12-11+/t14-,15-,16-,17-/m0/s1 |
| InChIKey | LVTRTHOQSHAEKM-YCLPPDEQSA-N |
| XLogP | 4.59 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.44 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|