C20H22N2O3 — CID 22856077
(1S,2R,6S)-2-amino-6-[[4-(1,3-benzoxazol-2-yl)phenyl]methoxy]cyclohexan-1-ol (PubChem CID 22856077) has the molecular formula C20H22N2O3 and a molecular weight of 338.41 g/mol. Its IUPAC name is (1S,2R,6S)-2-amino-6-[[4-(1,3-benzoxazol-2-yl)phenyl]methoxy]cyclohexan-1-ol.
| Compound Name | (1S,2R,6S)-2-amino-6-[[4-(1,3-benzoxazol-2-yl)phenyl]methoxy]cyclohexan-1-ol |
|---|---|
| PubChem CID | 22856077 |
| Molecular Formula | C20H22N2O3 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | (1S,2R,6S)-2-amino-6-[[4-(1,3-benzoxazol-2-yl)phenyl]methoxy]cyclohexan-1-ol |
| SMILES | N[C@@H]1CCC[C@H](OCc2ccc(-c3nc4ccccc4o3)cc2)[C@H]1O |
| InChI | InChI=1S/C20H22N2O3/c21-15-4-3-7-18(19(15)23)24-12-13-8-10-14(11-9-13)20-22-16-5-1-2-6-17(16)25-20/h1-2,5-6,8-11,15,18-19,23H,3-4,7,12,21H2/t15-,18+,19+/m1/s1 |
| InChIKey | KPAVLBHGLRGDNQ-MNEFBYGVSA-N |
| XLogP | 3.25 |
| TPSA | 81.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |