C34H41FN2O3 — CID 22856109
1-[(3aR,4R,7aR)-4-fluoro-7,7-diphenyl-3,3a,4,5,6,7a-hexahydro-1H-isoindol-2-yl]-2-[1-[2-hydroxyethyl(methyl)amino]propan-2-yloxy]-2-phenylethanone (PubChem CID 22856109) has the molecular formula C34H41FN2O3 and a molecular weight of 544.71 g/mol. Its IUPAC name is 1-[(3aR,4R,7aR)-4-fluoro-7,7-diphenyl-3,3a,4,5,6,7a-hexahydro-1H-isoindol-2-yl]-2-[1-[2-hydroxyethyl(methyl)amino]propan-2-yloxy]-2-phenylethanone.
| Compound Name | 1-[(3aR,4R,7aR)-4-fluoro-7,7-diphenyl-3,3a,4,5,6,7a-hexahydro-1H-isoindol-2-yl]-2-[1-[2-hydroxyethyl(methyl)amino]propan-2-yloxy]-2-phenylethanone |
|---|---|
| PubChem CID | 22856109 |
| Molecular Formula | C34H41FN2O3 |
| Molecular Weight | 544.71 g/mol |
| Exact Mass | 544.31 |
| IUPAC Name | 1-[(3aR,4R,7aR)-4-fluoro-7,7-diphenyl-3,3a,4,5,6,7a-hexahydro-1H-isoindol-2-yl]-2-[1-[2-hydroxyethyl(methyl)amino]propan-2-yloxy]-2-phenylethanone |
| SMILES | CC(CN(C)CCO)OC(C(=O)N1C[C@@H]2[C@H](F)CCC(c3ccccc3)(c3ccccc3)[C@@H]2C1)c1ccccc1 |
| InChI | InChI=1S/C34H41FN2O3/c1-25(22-36(2)20-21-38)40-32(26-12-6-3-7-13-26)33(39)37-23-29-30(24-37)34(19-18-31(29)35,27-14-8-4-9-15-27)28-16-10-5-11-17-28/h3-17,25,29-32,38H,18-24H2,1-2H3/t25?,29-,30+,31+,32?/m0/s1 |
| InChIKey | MACGJLZDXGSXAS-GUEHBYOUSA-N |
| XLogP | 5.25 |
| TPSA | 53.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.71 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |