C27H27FN4O4 — CID 22856521
methyl 2-[(3S,5S)-5-[[4-(4-carbamimidoyl-3-fluorophenyl)phenoxy]methyl]-1-(pyridine-3-carbonyl)pyrrolidin-3-yl]acetate (PubChem CID 22856521) has the molecular formula C27H27FN4O4 and a molecular weight of 490.54 g/mol. Its IUPAC name is methyl 2-[(3S,5S)-5-[[4-(4-carbamimidoyl-3-fluorophenyl)phenoxy]methyl]-1-(pyridine-3-carbonyl)pyrrolidin-3-yl]acetate.
| Compound Name | methyl 2-[(3S,5S)-5-[[4-(4-carbamimidoyl-3-fluorophenyl)phenoxy]methyl]-1-(pyridine-3-carbonyl)pyrrolidin-3-yl]acetate |
|---|---|
| PubChem CID | 22856521 |
| Molecular Formula | C27H27FN4O4 |
| Molecular Weight | 490.54 g/mol |
| Exact Mass | 490.20 |
| IUPAC Name | methyl 2-[(3S,5S)-5-[[4-(4-carbamimidoyl-3-fluorophenyl)phenoxy]methyl]-1-(pyridine-3-carbonyl)pyrrolidin-3-yl]acetate |
| SMILES | [H]/N=C(\N)c1ccc(-c2ccc(OC[C@@H]3C[C@@H](CC(=O)OC)CN3C(=O)c3cccnc3)cc2)cc1F |
| InChI | InChI=1S/C27H27FN4O4/c1-35-25(33)12-17-11-21(32(15-17)27(34)20-3-2-10-31-14-20)16-36-22-7-4-18(5-8-22)19-6-9-23(26(29)30)24(28)13-19/h2-10,13-14,17,21H,11-12,15-16H2,1H3,(H3,29,30)/t17-,21-/m0/s1 |
| InChIKey | IUKNFDKWYAFSTK-UWJYYQICSA-N |
| XLogP | 3.64 |
| TPSA | 118.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.54 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|