C21H31N5O3 — CID 22856611
methyl 2-[(3S,5S)-5-[[[1-(4-carbamimidoylphenyl)piperidin-4-yl]-methylamino]methyl]-2-oxopyrrolidin-3-yl]acetate (PubChem CID 22856611) has the molecular formula C21H31N5O3 and a molecular weight of 401.51 g/mol. Its IUPAC name is methyl 2-[(3S,5S)-5-[[[1-(4-carbamimidoylphenyl)piperidin-4-yl]-methylamino]methyl]-2-oxopyrrolidin-3-yl]acetate.
| Compound Name | methyl 2-[(3S,5S)-5-[[[1-(4-carbamimidoylphenyl)piperidin-4-yl]-methylamino]methyl]-2-oxopyrrolidin-3-yl]acetate |
|---|---|
| PubChem CID | 22856611 |
| Molecular Formula | C21H31N5O3 |
| Molecular Weight | 401.51 g/mol |
| Exact Mass | 401.24 |
| IUPAC Name | methyl 2-[(3S,5S)-5-[[[1-(4-carbamimidoylphenyl)piperidin-4-yl]-methylamino]methyl]-2-oxopyrrolidin-3-yl]acetate |
| SMILES | [H]/N=C(\N)c1ccc(N2CCC(N(C)C[C@@H]3C[C@@H](CC(=O)OC)C(=O)N3)CC2)cc1 |
| InChI | InChI=1S/C21H31N5O3/c1-25(13-16-11-15(21(28)24-16)12-19(27)29-2)17-7-9-26(10-8-17)18-5-3-14(4-6-18)20(22)23/h3-6,15-17H,7-13H2,1-2H3,(H3,22,23)(H,24,28)/t15-,16-/m0/s1 |
| InChIKey | BPNDOLHMFHOWBG-HOTGVXAUSA-N |
| XLogP | 0.94 |
| TPSA | 111.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.51 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|