About (3R,5S)-1-propan-2-yl-3,5-bis(sulfanylmethyl)pyrrolidin-2-one
(3R,5S)-1-propan-2-yl-3,5-bis(sulfanylmethyl)pyrrolidin-2-one (PubChem CID 22856959) has the molecular formula C9H17NOS2
and a molecular weight of 219.37 g/mol. Its IUPAC name is (3R,5S)-1-propan-2-yl-3,5-bis(sulfanylmethyl)pyrrolidin-2-one.
Molecular Properties
| Compound Name | (3R,5S)-1-propan-2-yl-3,5-bis(sulfanylmethyl)pyrrolidin-2-one |
| PubChem CID | 22856959 |
| Molecular Formula | C9H17NOS2 |
| Molecular Weight | 219.37 g/mol |
| Exact Mass | 219.08 |
| IUPAC Name | (3R,5S)-1-propan-2-yl-3,5-bis(sulfanylmethyl)pyrrolidin-2-one |
| SMILES | CC(C)N1C(=O)[C@H](CS)C[C@H]1CS |
| InChI | InChI=1S/C9H17NOS2/c1-6(2)10-8(5-13)3-7(4-12)9(10)11/h6-8,12-13H,3-5H2,1-2H3/t7-,8-/m0/s1 |
| InChIKey | ZYRWMTKFRHVGCH-YUMQZZPRSA-N |
| XLogP | 1.47 |
| TPSA | 20.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.37 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (3R,5S)-1-propan-2-yl-3,5-bis(sulfanylmethyl)pyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3R,5S)-1-propan-2-yl-3,5-bis(sulfanylmethyl)pyrrolidin-2-one?
The IUPAC name of (3R,5S)-1-propan-2-yl-3,5-bis(sulfanylmethyl)pyrrolidin-2-one (CID 22856959) is (3R,5S)-1-propan-2-yl-3,5-bis(sulfanylmethyl)pyrrolidin-2-one.
What is the SMILES notation for (3R,5S)-1-propan-2-yl-3,5-bis(sulfanylmethyl)pyrrolidin-2-one?
The canonical SMILES for (3R,5S)-1-propan-2-yl-3,5-bis(sulfanylmethyl)pyrrolidin-2-one is CC(C)N1C(=O)[C@H](CS)C[C@H]1CS.
What is the InChIKey of (3R,5S)-1-propan-2-yl-3,5-bis(sulfanylmethyl)pyrrolidin-2-one?
The InChIKey is ZYRWMTKFRHVGCH-YUMQZZPRSA-N. The full InChI is InChI=1S/C9H17NOS2/c1-6(2)10-8(5-13)3-7(4-12)9(10)11/h6-8,12-13H,3-5H2,1-2H3/t7-,8-/m0/s1.
What are the key properties of (3R,5S)-1-propan-2-yl-3,5-bis(sulfanylmethyl)pyrrolidin-2-one?
(3R,5S)-1-propan-2-yl-3,5-bis(sulfanylmethyl)pyrrolidin-2-one has a molecular weight of 219.37 g/mol, XLogP of 1.47, 3 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3R,5S)-1-propan-2-yl-3,5-bis(sulfanylmethyl)pyrrolidin-2-one is sourced from PubChem (CID 22856959), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).