C10H17NO5 — CID 22857242
(1S,2R,8R,8aR)-7-ethoxy-1,2,8-trihydroxy-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one (PubChem CID 22857242) has the molecular formula C10H17NO5 and a molecular weight of 231.25 g/mol. Its IUPAC name is (1S,2R,8R,8aR)-7-ethoxy-1,2,8-trihydroxy-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one.
| Compound Name | (1S,2R,8R,8aR)-7-ethoxy-1,2,8-trihydroxy-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one |
|---|---|
| PubChem CID | 22857242 |
| Molecular Formula | C10H17NO5 |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.11 |
| IUPAC Name | (1S,2R,8R,8aR)-7-ethoxy-1,2,8-trihydroxy-2,3,6,7,8,8a-hexahydro-1H-indolizin-5-one |
| SMILES | CCOC1CC(=O)N2C[C@@H](O)[C@@H](O)[C@@H]2[C@H]1O |
| InChI | InChI=1S/C10H17NO5/c1-2-16-6-3-7(13)11-4-5(12)9(14)8(11)10(6)15/h5-6,8-10,12,14-15H,2-4H2,1H3/t5-,6?,8-,9-,10+/m1/s1 |
| InChIKey | OONULGCVSMVUAX-JXWPGTDQSA-N |
| XLogP | -1.91 |
| TPSA | 90.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | -1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |