C14H19NO10 — CID 22857247
[(1S,2R,8R,8aR)-1,2-bis(acetylperoxy)-5-oxo-2,3,6,7,8,8a-hexahydro-1H-indolizin-8-yl] ethaneperoxoate (PubChem CID 22857247) has the molecular formula C14H19NO10 and a molecular weight of 361.30 g/mol. Its IUPAC name is [(1S,2R,8R,8aR)-1,2-bis(acetylperoxy)-5-oxo-2,3,6,7,8,8a-hexahydro-1H-indolizin-8-yl] ethaneperoxoate.
| Compound Name | [(1S,2R,8R,8aR)-1,2-bis(acetylperoxy)-5-oxo-2,3,6,7,8,8a-hexahydro-1H-indolizin-8-yl] ethaneperoxoate |
|---|---|
| PubChem CID | 22857247 |
| Molecular Formula | C14H19NO10 |
| Molecular Weight | 361.30 g/mol |
| Exact Mass | 361.10 |
| IUPAC Name | [(1S,2R,8R,8aR)-1,2-bis(acetylperoxy)-5-oxo-2,3,6,7,8,8a-hexahydro-1H-indolizin-8-yl] ethaneperoxoate |
| SMILES | CC(=O)OO[C@H]1[C@H]2[C@H](OOC(C)=O)CCC(=O)N2C[C@H]1OOC(C)=O |
| InChI | InChI=1S/C14H19NO10/c1-7(16)20-23-10-4-5-12(19)15-6-11(24-21-8(2)17)14(13(10)15)25-22-9(3)18/h10-11,13-14H,4-6H2,1-3H3/t10-,11-,13-,14-/m1/s1 |
| InChIKey | FHYWWTHQPXOYSH-HBJVGIJOSA-N |
| XLogP | -0.42 |
| TPSA | 126.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.30 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|