C24H27N3O2 — CID 22857296
benzyl N-[[(6aR,9S,10aR)-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]methyl]carbamate (PubChem CID 22857296) has the molecular formula C24H27N3O2 and a molecular weight of 389.50 g/mol. Its IUPAC name is benzyl N-[[(6aR,9S,10aR)-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]methyl]carbamate.
| Compound Name | benzyl N-[[(6aR,9S,10aR)-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]methyl]carbamate |
|---|---|
| PubChem CID | 22857296 |
| Molecular Formula | C24H27N3O2 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.21 |
| IUPAC Name | benzyl N-[[(6aR,9S,10aR)-7-methyl-6,6a,8,9,10,10a-hexahydro-4H-indolo[4,3-fg]quinolin-9-yl]methyl]carbamate |
| SMILES | CN1C[C@H](CNC(=O)OCc2ccccc2)C[C@@H]2c3cccc4[nH]cc(c34)C[C@H]21 |
| InChI | InChI=1S/C24H27N3O2/c1-27-14-17(12-26-24(28)29-15-16-6-3-2-4-7-16)10-20-19-8-5-9-21-23(19)18(13-25-21)11-22(20)27/h2-9,13,17,20,22,25H,10-12,14-15H2,1H3,(H,26,28)/t17-,20+,22+/m0/s1 |
| InChIKey | REJFPXMKRRYBSC-UCNVEGJOSA-N |
| XLogP | 4.05 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |