C26H24N4O2 — CID 22857563
2-[2-[(7R)-2,5,19-triazatetracyclo[13.4.0.02,7.08,13]nonadeca-1(15),8,10,12,16,18-hexaen-5-yl]ethyl]isoindole-1,3-dione (PubChem CID 22857563) has the molecular formula C26H24N4O2 and a molecular weight of 424.50 g/mol. Its IUPAC name is 2-[2-[(7R)-2,5,19-triazatetracyclo[13.4.0.02,7.08,13]nonadeca-1(15),8,10,12,16,18-hexaen-5-yl]ethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-[(7R)-2,5,19-triazatetracyclo[13.4.0.02,7.08,13]nonadeca-1(15),8,10,12,16,18-hexaen-5-yl]ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 22857563 |
| Molecular Formula | C26H24N4O2 |
| Molecular Weight | 424.50 g/mol |
| Exact Mass | 424.19 |
| IUPAC Name | 2-[2-[(7R)-2,5,19-triazatetracyclo[13.4.0.02,7.08,13]nonadeca-1(15),8,10,12,16,18-hexaen-5-yl]ethyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CCN1CCN2c3ncccc3Cc3ccccc3[C@@H]2C1 |
| InChI | InChI=1S/C26H24N4O2/c31-25-21-9-3-4-10-22(21)26(32)30(25)15-13-28-12-14-29-23(17-28)20-8-2-1-6-18(20)16-19-7-5-11-27-24(19)29/h1-11,23H,12-17H2/t23-/m0/s1 |
| InChIKey | UUFXOEDYDYXSIG-QHCPKHFHSA-N |
| XLogP | 3.15 |
| TPSA | 56.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.50 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|