C24H24FNO4 — CID 22857844
N-[3-fluoro-5-(naphthalen-2-ylmethoxy)phenoxy]-1-(2,2,4-trimethyl-1,3-dioxolan-4-yl)methanimine (PubChem CID 22857844) has the molecular formula C24H24FNO4 and a molecular weight of 409.46 g/mol. Its IUPAC name is N-[3-fluoro-5-(naphthalen-2-ylmethoxy)phenoxy]-1-(2,2,4-trimethyl-1,3-dioxolan-4-yl)methanimine.
| Compound Name | N-[3-fluoro-5-(naphthalen-2-ylmethoxy)phenoxy]-1-(2,2,4-trimethyl-1,3-dioxolan-4-yl)methanimine |
|---|---|
| PubChem CID | 22857844 |
| Molecular Formula | C24H24FNO4 |
| Molecular Weight | 409.46 g/mol |
| Exact Mass | 409.17 |
| IUPAC Name | N-[3-fluoro-5-(naphthalen-2-ylmethoxy)phenoxy]-1-(2,2,4-trimethyl-1,3-dioxolan-4-yl)methanimine |
| SMILES | CC1(C=NOc2cc(F)cc(OCc3ccc4ccccc4c3)c2)COC(C)(C)O1 |
| InChI | InChI=1S/C24H24FNO4/c1-23(2)28-16-24(3,30-23)15-26-29-22-12-20(25)11-21(13-22)27-14-17-8-9-18-6-4-5-7-19(18)10-17/h4-13,15H,14,16H2,1-3H3 |
| InChIKey | IHRWVQPHGZDXDF-UHFFFAOYSA-N |
| XLogP | 5.46 |
| TPSA | 49.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.46 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|