C29H36O2 — CID 22857880
ethyl 2-[(1E,3Z)-4-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)penta-1,3-dienyl]benzoate (PubChem CID 22857880) has the molecular formula C29H36O2 and a molecular weight of 416.61 g/mol. Its IUPAC name is ethyl 2-[(1E,3Z)-4-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)penta-1,3-dienyl]benzoate.
| Compound Name | ethyl 2-[(1E,3Z)-4-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)penta-1,3-dienyl]benzoate |
|---|---|
| PubChem CID | 22857880 |
| Molecular Formula | C29H36O2 |
| Molecular Weight | 416.61 g/mol |
| Exact Mass | 416.27 |
| IUPAC Name | ethyl 2-[(1E,3Z)-4-(3,5,5,8,8-pentamethyl-6,7-dihydronaphthalen-2-yl)penta-1,3-dienyl]benzoate |
| SMILES | CCOC(=O)c1ccccc1/C=C/C=C(/C)c1cc2c(cc1C)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C29H36O2/c1-8-31-27(30)23-15-10-9-13-22(23)14-11-12-20(2)24-19-26-25(18-21(24)3)28(4,5)16-17-29(26,6)7/h9-15,18-19H,8,16-17H2,1-7H3/b14-11+,20-12- |
| InChIKey | MIRVRZMSIQXZTM-ZIVDUOCNSA-N |
| XLogP | 7.64 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.61 |
| LogP ≤ 5 | 7.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|