C13H16N5O4+ — CID 2285790
N-[1,3-bis(furan-2-ylmethyl)-2,6-dihydro-1H-1,3,5-triazin-1-ium-4-yl]nitramide (PubChem CID 2285790) has the molecular formula C13H16N5O4+ and a molecular weight of 306.30 g/mol. Its IUPAC name is N-[1,3-bis(furan-2-ylmethyl)-2,6-dihydro-1H-1,3,5-triazin-1-ium-4-yl]nitramide.
| Compound Name | N-[1,3-bis(furan-2-ylmethyl)-2,6-dihydro-1H-1,3,5-triazin-1-ium-4-yl]nitramide |
|---|---|
| PubChem CID | 2285790 |
| Molecular Formula | C13H16N5O4+ |
| Molecular Weight | 306.30 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | N-[1,3-bis(furan-2-ylmethyl)-2,6-dihydro-1H-1,3,5-triazin-1-ium-4-yl]nitramide |
| SMILES | O=[N+]([O-])NC1=NC[NH+](Cc2ccco2)CN1Cc1ccco1 |
| InChI | InChI=1S/C13H15N5O4/c19-18(20)15-13-14-9-16(7-11-3-1-5-21-11)10-17(13)8-12-4-2-6-22-12/h1-6H,7-10H2,(H,14,15)/p+1 |
| InChIKey | JVPFLGAVHMWNSY-UHFFFAOYSA-O |
| XLogP | -0.17 |
| TPSA | 101.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.30 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|