About 6-amino-5-fluoro-3-[(2R,5S)-5-(hydroxymethyl)oxolan-2-yl]-4H-1,3-thiazin-2-one
6-amino-5-fluoro-3-[(2R,5S)-5-(hydroxymethyl)oxolan-2-yl]-4H-1,3-thiazin-2-one (PubChem CID 22857969) has the molecular formula C9H13FN2O3S
and a molecular weight of 248.28 g/mol. Its IUPAC name is 6-amino-5-fluoro-3-[(2R,5S)-5-(hydroxymethyl)oxolan-2-yl]-4H-1,3-thiazin-2-one.
Molecular Properties
| Compound Name | 6-amino-5-fluoro-3-[(2R,5S)-5-(hydroxymethyl)oxolan-2-yl]-4H-1,3-thiazin-2-one |
| PubChem CID | 22857969 |
| Molecular Formula | C9H13FN2O3S |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.06 |
| IUPAC Name | 6-amino-5-fluoro-3-[(2R,5S)-5-(hydroxymethyl)oxolan-2-yl]-4H-1,3-thiazin-2-one |
| SMILES | NC1=C(F)CN([C@H]2CC[C@@H](CO)O2)C(=O)S1 |
| InChI | InChI=1S/C9H13FN2O3S/c10-6-3-12(9(14)16-8(6)11)7-2-1-5(4-13)15-7/h5,7,13H,1-4,11H2/t5-,7+/m0/s1 |
| InChIKey | LIRIGVRNYRWCQQ-CAHLUQPWSA-N |
| XLogP | 0.75 |
| TPSA | 75.79 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze 6-amino-5-fluoro-3-[(2R,5S)-5-(hydroxymethyl)oxolan-2-yl]-4H-1,3-thiazin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-5-fluoro-3-[(2R,5S)-5-(hydroxymethyl)oxolan-2-yl]-4H-1,3-thiazin-2-one?
The IUPAC name of 6-amino-5-fluoro-3-[(2R,5S)-5-(hydroxymethyl)oxolan-2-yl]-4H-1,3-thiazin-2-one (CID 22857969) is 6-amino-5-fluoro-3-[(2R,5S)-5-(hydroxymethyl)oxolan-2-yl]-4H-1,3-thiazin-2-one.
What is the SMILES notation for 6-amino-5-fluoro-3-[(2R,5S)-5-(hydroxymethyl)oxolan-2-yl]-4H-1,3-thiazin-2-one?
The canonical SMILES for 6-amino-5-fluoro-3-[(2R,5S)-5-(hydroxymethyl)oxolan-2-yl]-4H-1,3-thiazin-2-one is NC1=C(F)CN([C@H]2CC[C@@H](CO)O2)C(=O)S1.
What is the InChIKey of 6-amino-5-fluoro-3-[(2R,5S)-5-(hydroxymethyl)oxolan-2-yl]-4H-1,3-thiazin-2-one?
The InChIKey is LIRIGVRNYRWCQQ-CAHLUQPWSA-N. The full InChI is InChI=1S/C9H13FN2O3S/c10-6-3-12(9(14)16-8(6)11)7-2-1-5(4-13)15-7/h5,7,13H,1-4,11H2/t5-,7+/m0/s1.
What are the key properties of 6-amino-5-fluoro-3-[(2R,5S)-5-(hydroxymethyl)oxolan-2-yl]-4H-1,3-thiazin-2-one?
6-amino-5-fluoro-3-[(2R,5S)-5-(hydroxymethyl)oxolan-2-yl]-4H-1,3-thiazin-2-one has a molecular weight of 248.28 g/mol, XLogP of 0.75, 2 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-5-fluoro-3-[(2R,5S)-5-(hydroxymethyl)oxolan-2-yl]-4H-1,3-thiazin-2-one is sourced from PubChem (CID 22857969), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).