C19H30O — CID 22858129
(1S,2S,8S,11S,12S,16S)-2,16-dimethyl-5-oxapentacyclo[9.7.0.02,8.04,6.012,16]octadecane (PubChem CID 22858129) has the molecular formula C19H30O and a molecular weight of 274.45 g/mol. Its IUPAC name is (1S,2S,8S,11S,12S,16S)-2,16-dimethyl-5-oxapentacyclo[9.7.0.02,8.04,6.012,16]octadecane.
| Compound Name | (1S,2S,8S,11S,12S,16S)-2,16-dimethyl-5-oxapentacyclo[9.7.0.02,8.04,6.012,16]octadecane |
|---|---|
| PubChem CID | 22858129 |
| Molecular Formula | C19H30O |
| Molecular Weight | 274.45 g/mol |
| Exact Mass | 274.23 |
| IUPAC Name | (1S,2S,8S,11S,12S,16S)-2,16-dimethyl-5-oxapentacyclo[9.7.0.02,8.04,6.012,16]octadecane |
| SMILES | C[C@@]12CCC[C@H]1[C@@H]1CC[C@H]3CC4OC4C[C@]3(C)[C@H]1CC2 |
| InChI | InChI=1S/C19H30O/c1-18-8-3-4-14(18)13-6-5-12-10-16-17(20-16)11-19(12,2)15(13)7-9-18/h12-17H,3-11H2,1-2H3/t12-,13-,14-,15-,16?,17?,18-,19-/m0/s1 |
| InChIKey | LNJPUBRJDXMORJ-JMMWLAGUSA-N |
| XLogP | 4.80 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.45 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|