C11H13NO7 — CID 22858542
(2R,3S,4S)-2-(hydroxymethyl)-5-(4-nitrophenoxy)oxolane-3,4-diol (PubChem CID 22858542) has the molecular formula C11H13NO7 and a molecular weight of 271.23 g/mol. Its IUPAC name is (2R,3S,4S)-2-(hydroxymethyl)-5-(4-nitrophenoxy)oxolane-3,4-diol.
| Compound Name | (2R,3S,4S)-2-(hydroxymethyl)-5-(4-nitrophenoxy)oxolane-3,4-diol |
|---|---|
| PubChem CID | 22858542 |
| Molecular Formula | C11H13NO7 |
| Molecular Weight | 271.23 g/mol |
| Exact Mass | 271.07 |
| IUPAC Name | (2R,3S,4S)-2-(hydroxymethyl)-5-(4-nitrophenoxy)oxolane-3,4-diol |
| SMILES | O=[N+]([O-])c1ccc(OC2O[C@H](CO)[C@@H](O)[C@@H]2O)cc1 |
| InChI | InChI=1S/C11H13NO7/c13-5-8-9(14)10(15)11(19-8)18-7-3-1-6(2-4-7)12(16)17/h1-4,8-11,13-15H,5H2/t8-,9-,10+,11?/m1/s1 |
| InChIKey | DUYYBTBDYZXISX-NFLHVTIKSA-N |
| XLogP | -0.59 |
| TPSA | 122.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.23 |
| LogP ≤ 5 | -0.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|