C16H24O4 — CID 22858612
methyl 5-[(3'aR,6'aS)-spiro[1,3-dioxolane-2,5'-3a,4,6,6a-tetrahydro-1H-pentalene]-2'-yl]pentanoate (PubChem CID 22858612) has the molecular formula C16H24O4 and a molecular weight of 280.36 g/mol. Its IUPAC name is methyl 5-[(3'aR,6'aS)-spiro[1,3-dioxolane-2,5'-3a,4,6,6a-tetrahydro-1H-pentalene]-2'-yl]pentanoate.
| Compound Name | methyl 5-[(3'aR,6'aS)-spiro[1,3-dioxolane-2,5'-3a,4,6,6a-tetrahydro-1H-pentalene]-2'-yl]pentanoate |
|---|---|
| PubChem CID | 22858612 |
| Molecular Formula | C16H24O4 |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.17 |
| IUPAC Name | methyl 5-[(3'aR,6'aS)-spiro[1,3-dioxolane-2,5'-3a,4,6,6a-tetrahydro-1H-pentalene]-2'-yl]pentanoate |
| SMILES | COC(=O)CCCCC1=C[C@@H]2CC3(C[C@@H]2C1)OCCO3 |
| InChI | InChI=1S/C16H24O4/c1-18-15(17)5-3-2-4-12-8-13-10-16(11-14(13)9-12)19-6-7-20-16/h8,13-14H,2-7,9-11H2,1H3/t13-,14+/m1/s1 |
| InChIKey | XMSPEUDJQYCAJM-KGLIPLIRSA-N |
| XLogP | 2.82 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|