C12H18O5S — CID 22858639
(1S,2R,6R,8S,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-8-carbothialdehyde (PubChem CID 22858639) has the molecular formula C12H18O5S and a molecular weight of 274.34 g/mol. Its IUPAC name is (1S,2R,6R,8S,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-8-carbothialdehyde.
| Compound Name | (1S,2R,6R,8S,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-8-carbothialdehyde |
|---|---|
| PubChem CID | 22858639 |
| Molecular Formula | C12H18O5S |
| Molecular Weight | 274.34 g/mol |
| Exact Mass | 274.09 |
| IUPAC Name | (1S,2R,6R,8S,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-8-carbothialdehyde |
| SMILES | CC1(C)O[C@H]2[C@@H](O1)[C@@H](C=S)O[C@@H]1OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C12H18O5S/c1-11(2)14-7-6(5-18)13-10-9(8(7)15-11)16-12(3,4)17-10/h5-10H,1-4H3/t6-,7+,8+,9-,10-/m1/s1 |
| InChIKey | NNDHGPYNXPMNAU-SOYHJAILSA-N |
| XLogP | 1.38 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.34 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|