C29H38O6 — CID 22858842
[8-[2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl]-7-methyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] (2R)-2-(4-methylphenoxy)butanoate (PubChem CID 22858842) has the molecular formula C29H38O6 and a molecular weight of 482.62 g/mol. Its IUPAC name is [8-[2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl]-7-methyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] (2R)-2-(4-methylphenoxy)butanoate.
| Compound Name | [8-[2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl]-7-methyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] (2R)-2-(4-methylphenoxy)butanoate |
|---|---|
| PubChem CID | 22858842 |
| Molecular Formula | C29H38O6 |
| Molecular Weight | 482.62 g/mol |
| Exact Mass | 482.27 |
| IUPAC Name | [8-[2-[(2R,4R)-4-hydroxy-6-oxooxan-2-yl]ethyl]-7-methyl-1,2,3,7,8,8a-hexahydronaphthalen-1-yl] (2R)-2-(4-methylphenoxy)butanoate |
| SMILES | CC[C@@H](Oc1ccc(C)cc1)C(=O)OC1CCC=C2C=CC(C)C(CC[C@@H]3C[C@@H](O)CC(=O)O3)C21 |
| InChI | InChI=1S/C29H38O6/c1-4-25(33-22-12-8-18(2)9-13-22)29(32)35-26-7-5-6-20-11-10-19(3)24(28(20)26)15-14-23-16-21(30)17-27(31)34-23/h6,8-13,19,21,23-26,28,30H,4-5,7,14-17H2,1-3H3/t19?,21-,23-,24?,25-,26?,28?/m1/s1 |
| InChIKey | ZYVXSFXQDGBDGU-OHEAFPAKSA-N |
| XLogP | 5.07 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.62 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |