C17H15F6NO — CID 22859115
(1S)-2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1-phenylethanamine (PubChem CID 22859115) has the molecular formula C17H15F6NO and a molecular weight of 363.30 g/mol. Its IUPAC name is (1S)-2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1-phenylethanamine.
| Compound Name | (1S)-2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1-phenylethanamine |
|---|---|
| PubChem CID | 22859115 |
| Molecular Formula | C17H15F6NO |
| Molecular Weight | 363.30 g/mol |
| Exact Mass | 363.11 |
| IUPAC Name | (1S)-2-[[3,5-bis(trifluoromethyl)phenyl]methoxy]-1-phenylethanamine |
| SMILES | N[C@H](COCc1cc(C(F)(F)F)cc(C(F)(F)F)c1)c1ccccc1 |
| InChI | InChI=1S/C17H15F6NO/c18-16(19,20)13-6-11(7-14(8-13)17(21,22)23)9-25-10-15(24)12-4-2-1-3-5-12/h1-8,15H,9-10,24H2/t15-/m1/s1 |
| InChIKey | UYZIPLMTFSGKAJ-OAHLLOKOSA-N |
| XLogP | 4.94 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.30 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |