C14H26O5Si — CID 22859285
[(2R,3S,4R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-hydroxy-3,4-dihydro-2H-pyran-4-yl] acetate (PubChem CID 22859285) has the molecular formula C14H26O5Si and a molecular weight of 302.44 g/mol. Its IUPAC name is [(2R,3S,4R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-hydroxy-3,4-dihydro-2H-pyran-4-yl] acetate.
| Compound Name | [(2R,3S,4R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-hydroxy-3,4-dihydro-2H-pyran-4-yl] acetate |
|---|---|
| PubChem CID | 22859285 |
| Molecular Formula | C14H26O5Si |
| Molecular Weight | 302.44 g/mol |
| Exact Mass | 302.15 |
| IUPAC Name | [(2R,3S,4R)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-3-hydroxy-3,4-dihydro-2H-pyran-4-yl] acetate |
| SMILES | CC(=O)O[C@@H]1C=CO[C@H](CO[Si](C)(C)C(C)(C)C)[C@H]1O |
| InChI | InChI=1S/C14H26O5Si/c1-10(15)19-11-7-8-17-12(13(11)16)9-18-20(5,6)14(2,3)4/h7-8,11-13,16H,9H2,1-6H3/t11-,12-,13+/m1/s1 |
| InChIKey | QPDUQJUAHAKKKM-UPJWGTAASA-N |
| XLogP | 2.21 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.44 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|