C10H17NO9S2 — CID 22859393
[(1S,2S,6R,9S)-11,11-dimethyl-4,4-dioxo-3,5,10,12-tetraoxa-4λ6-thiatricyclo[7.3.0.02,6]dodecan-9-yl]methyl sulfamate (PubChem CID 22859393) has the molecular formula C10H17NO9S2 and a molecular weight of 359.38 g/mol. Its IUPAC name is [(1S,2S,6R,9S)-11,11-dimethyl-4,4-dioxo-3,5,10,12-tetraoxa-4λ6-thiatricyclo[7.3.0.02,6]dodecan-9-yl]methyl sulfamate.
| Compound Name | [(1S,2S,6R,9S)-11,11-dimethyl-4,4-dioxo-3,5,10,12-tetraoxa-4λ6-thiatricyclo[7.3.0.02,6]dodecan-9-yl]methyl sulfamate |
|---|---|
| PubChem CID | 22859393 |
| Molecular Formula | C10H17NO9S2 |
| Molecular Weight | 359.38 g/mol |
| Exact Mass | 359.03 |
| IUPAC Name | [(1S,2S,6R,9S)-11,11-dimethyl-4,4-dioxo-3,5,10,12-tetraoxa-4λ6-thiatricyclo[7.3.0.02,6]dodecan-9-yl]methyl sulfamate |
| SMILES | CC1(C)O[C@H]2[C@@H]3OS(=O)(=O)O[C@@H]3CC[C@@]2(COS(N)(=O)=O)O1 |
| InChI | InChI=1S/C10H17NO9S2/c1-9(2)17-8-7-6(18-22(14,15)19-7)3-4-10(8,20-9)5-16-21(11,12)13/h6-8H,3-5H2,1-2H3,(H2,11,12,13)/t6-,7-,8+,10+/m1/s1 |
| InChIKey | MIVONOYHFHTRNM-ODXREFDESA-N |
| XLogP | -1.08 |
| TPSA | 140.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.38 |
| LogP ≤ 5 | -1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |