About (3S,6S)-6-methoxyoxan-3-ol
(3S,6S)-6-methoxyoxan-3-ol (PubChem CID 22859546) has the molecular formula C6H12O3
and a molecular weight of 132.16 g/mol. Its IUPAC name is (3S,6S)-6-methoxyoxan-3-ol.
Molecular Properties
| Compound Name | (3S,6S)-6-methoxyoxan-3-ol |
| PubChem CID | 22859546 |
| Molecular Formula | C6H12O3 |
| Molecular Weight | 132.16 g/mol |
| Exact Mass | 132.08 |
| IUPAC Name | (3S,6S)-6-methoxyoxan-3-ol |
| SMILES | CO[C@@H]1CC[C@H](O)CO1 |
| InChI | InChI=1S/C6H12O3/c1-8-6-3-2-5(7)4-9-6/h5-7H,2-4H2,1H3/t5-,6-/m0/s1 |
| InChIKey | MGCVEMGADCDADD-WDSKDSINSA-N |
| XLogP | 0.13 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.16 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3S,6S)-6-methoxyoxan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S,6S)-6-methoxyoxan-3-ol?
The IUPAC name of (3S,6S)-6-methoxyoxan-3-ol (CID 22859546) is (3S,6S)-6-methoxyoxan-3-ol.
What is the SMILES notation for (3S,6S)-6-methoxyoxan-3-ol?
The canonical SMILES for (3S,6S)-6-methoxyoxan-3-ol is CO[C@@H]1CC[C@H](O)CO1.
What is the InChIKey of (3S,6S)-6-methoxyoxan-3-ol?
The InChIKey is MGCVEMGADCDADD-WDSKDSINSA-N. The full InChI is InChI=1S/C6H12O3/c1-8-6-3-2-5(7)4-9-6/h5-7H,2-4H2,1H3/t5-,6-/m0/s1.
What are the key properties of (3S,6S)-6-methoxyoxan-3-ol?
(3S,6S)-6-methoxyoxan-3-ol has a molecular weight of 132.16 g/mol, XLogP of 0.13, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3S,6S)-6-methoxyoxan-3-ol is sourced from PubChem (CID 22859546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).