C27H30BrN5O4 — CID 22859976
(2S)-2-[[3-bromo-2-[2-(2H-tetrazol-5-yl)phenyl]-1-benzofuran-5-yl]methyl-hexanoylamino]-3-methylbutanoic acid (PubChem CID 22859976) has the molecular formula C27H30BrN5O4 and a molecular weight of 568.47 g/mol. Its IUPAC name is (2S)-2-[[3-bromo-2-[2-(2H-tetrazol-5-yl)phenyl]-1-benzofuran-5-yl]methyl-hexanoylamino]-3-methylbutanoic acid.
| Compound Name | (2S)-2-[[3-bromo-2-[2-(2H-tetrazol-5-yl)phenyl]-1-benzofuran-5-yl]methyl-hexanoylamino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 22859976 |
| Molecular Formula | C27H30BrN5O4 |
| Molecular Weight | 568.47 g/mol |
| Exact Mass | 567.15 |
| IUPAC Name | (2S)-2-[[3-bromo-2-[2-(2H-tetrazol-5-yl)phenyl]-1-benzofuran-5-yl]methyl-hexanoylamino]-3-methylbutanoic acid |
| SMILES | CCCCCC(=O)N(Cc1ccc2oc(-c3ccccc3-c3nn[nH]n3)c(Br)c2c1)[C@H](C(=O)O)C(C)C |
| InChI | InChI=1S/C27H30BrN5O4/c1-4-5-6-11-22(34)33(24(16(2)3)27(35)36)15-17-12-13-21-20(14-17)23(28)25(37-21)18-9-7-8-10-19(18)26-29-31-32-30-26/h7-10,12-14,16,24H,4-6,11,15H2,1-3H3,(H,35,36)(H,29,30,31,32)/t24-/m0/s1 |
| InChIKey | BDFQZIJGOXSLQH-DEOSSOPVSA-N |
| XLogP | 6.06 |
| TPSA | 125.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 568.47 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|