About magnesium;hydride;2-methylpropane
magnesium;hydride;2-methylpropane (PubChem CID 22860213) has the molecular formula C4H10Mg
and a molecular weight of 82.43 g/mol. Its IUPAC name is magnesium;hydride;2-methylpropane.
Molecular Properties
| Compound Name | magnesium;hydride;2-methylpropane |
| PubChem CID | 22860213 |
| Molecular Formula | C4H10Mg |
| Molecular Weight | 82.43 g/mol |
| Exact Mass | 82.06 |
| IUPAC Name | magnesium;hydride;2-methylpropane |
| SMILES | C[C-](C)C.[H-].[Mg+2] |
| InChI | InChI=1S/C4H9.Mg.H/c1-4(2)3;;/h1-3H3;;/q-1;+2;-1 |
| InChIKey | WXSITEPMMANCOI-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 82.43 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze magnesium;hydride;2-methylpropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium;hydride;2-methylpropane?
The IUPAC name of magnesium;hydride;2-methylpropane (CID 22860213) is magnesium;hydride;2-methylpropane.
What is the SMILES notation for magnesium;hydride;2-methylpropane?
The canonical SMILES for magnesium;hydride;2-methylpropane is C[C-](C)C.[H-].[Mg+2].
What is the InChIKey of magnesium;hydride;2-methylpropane?
The InChIKey is WXSITEPMMANCOI-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9.Mg.H/c1-4(2)3;;/h1-3H3;;/q-1;+2;-1.
What are the key properties of magnesium;hydride;2-methylpropane?
magnesium;hydride;2-methylpropane has a molecular weight of 82.43 g/mol, XLogP of 1.35, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium;hydride;2-methylpropane is sourced from PubChem (CID 22860213), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).