C30H41F3N2O7 — CID 22860275
(4S,5R,6R,7S)-4,7-dibenzyl-5,6-bis(2-methoxyethoxymethoxy)-1-(3,3,3-trifluoropropyl)-1,3-diazepan-2-one (PubChem CID 22860275) has the molecular formula C30H41F3N2O7 and a molecular weight of 598.66 g/mol. Its IUPAC name is (4S,5R,6R,7S)-4,7-dibenzyl-5,6-bis(2-methoxyethoxymethoxy)-1-(3,3,3-trifluoropropyl)-1,3-diazepan-2-one.
| Compound Name | (4S,5R,6R,7S)-4,7-dibenzyl-5,6-bis(2-methoxyethoxymethoxy)-1-(3,3,3-trifluoropropyl)-1,3-diazepan-2-one |
|---|---|
| PubChem CID | 22860275 |
| Molecular Formula | C30H41F3N2O7 |
| Molecular Weight | 598.66 g/mol |
| Exact Mass | 598.29 |
| IUPAC Name | (4S,5R,6R,7S)-4,7-dibenzyl-5,6-bis(2-methoxyethoxymethoxy)-1-(3,3,3-trifluoropropyl)-1,3-diazepan-2-one |
| SMILES | COCCOCO[C@H]1[C@H](OCOCCOC)[C@H](Cc2ccccc2)N(CCC(F)(F)F)C(=O)N[C@H]1Cc1ccccc1 |
| InChI | InChI=1S/C30H41F3N2O7/c1-37-15-17-39-21-41-27-25(19-23-9-5-3-6-10-23)34-29(36)35(14-13-30(31,32)33)26(20-24-11-7-4-8-12-24)28(27)42-22-40-18-16-38-2/h3-12,25-28H,13-22H2,1-2H3,(H,34,36)/t25-,26-,27+,28+/m0/s1 |
| InChIKey | GGHAWQHOULRROM-YVHASNINSA-N |
| XLogP | 4.20 |
| TPSA | 87.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.66 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|