About 6-[4-[(2S,4R)-4-hydroxy-2-methyloxan-4-yl]thiophen-2-yl]sulfanyl-1-methylquinolin-2-one
6-[4-[(2S,4R)-4-hydroxy-2-methyloxan-4-yl]thiophen-2-yl]sulfanyl-1-methylquinolin-2-one (PubChem CID 22860812) has the molecular formula C20H21NO3S2
and a molecular weight of 387.53 g/mol. Its IUPAC name is 6-[4-[(2S,4R)-4-hydroxy-2-methyloxan-4-yl]thiophen-2-yl]sulfanyl-1-methylquinolin-2-one.
Molecular Properties
| Compound Name | 6-[4-[(2S,4R)-4-hydroxy-2-methyloxan-4-yl]thiophen-2-yl]sulfanyl-1-methylquinolin-2-one |
| PubChem CID | 22860812 |
| Molecular Formula | C20H21NO3S2 |
| Molecular Weight | 387.53 g/mol |
| Exact Mass | 387.10 |
| IUPAC Name | 6-[4-[(2S,4R)-4-hydroxy-2-methyloxan-4-yl]thiophen-2-yl]sulfanyl-1-methylquinolin-2-one |
| SMILES | C[C@H]1C[C@@](O)(c2csc(Sc3ccc4c(ccc(=O)n4C)c3)c2)CCO1 |
| InChI | InChI=1S/C20H21NO3S2/c1-13-11-20(23,7-8-24-13)15-10-19(25-12-15)26-16-4-5-17-14(9-16)3-6-18(22)21(17)2/h3-6,9-10,12-13,23H,7-8,11H2,1-2H3/t13-,20+/m0/s1 |
| InChIKey | UWDHQYJVHPCTHK-RNODOKPDSA-N |
| XLogP | 4.14 |
| TPSA | 51.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 387.53 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 6-[4-[(2S,4R)-4-hydroxy-2-methyloxan-4-yl]thiophen-2-yl]sulfanyl-1-methylquinolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[4-[(2S,4R)-4-hydroxy-2-methyloxan-4-yl]thiophen-2-yl]sulfanyl-1-methylquinolin-2-one?
The IUPAC name of 6-[4-[(2S,4R)-4-hydroxy-2-methyloxan-4-yl]thiophen-2-yl]sulfanyl-1-methylquinolin-2-one (CID 22860812) is 6-[4-[(2S,4R)-4-hydroxy-2-methyloxan-4-yl]thiophen-2-yl]sulfanyl-1-methylquinolin-2-one.
What is the SMILES notation for 6-[4-[(2S,4R)-4-hydroxy-2-methyloxan-4-yl]thiophen-2-yl]sulfanyl-1-methylquinolin-2-one?
The canonical SMILES for 6-[4-[(2S,4R)-4-hydroxy-2-methyloxan-4-yl]thiophen-2-yl]sulfanyl-1-methylquinolin-2-one is C[C@H]1C[C@@](O)(c2csc(Sc3ccc4c(ccc(=O)n4C)c3)c2)CCO1.
What is the InChIKey of 6-[4-[(2S,4R)-4-hydroxy-2-methyloxan-4-yl]thiophen-2-yl]sulfanyl-1-methylquinolin-2-one?
The InChIKey is UWDHQYJVHPCTHK-RNODOKPDSA-N. The full InChI is InChI=1S/C20H21NO3S2/c1-13-11-20(23,7-8-24-13)15-10-19(25-12-15)26-16-4-5-17-14(9-16)3-6-18(22)21(17)2/h3-6,9-10,12-13,23H,7-8,11H2,1-2H3/t13-,20+/m0/s1.
What are the key properties of 6-[4-[(2S,4R)-4-hydroxy-2-methyloxan-4-yl]thiophen-2-yl]sulfanyl-1-methylquinolin-2-one?
6-[4-[(2S,4R)-4-hydroxy-2-methyloxan-4-yl]thiophen-2-yl]sulfanyl-1-methylquinolin-2-one has a molecular weight of 387.53 g/mol, XLogP of 4.14, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[4-[(2S,4R)-4-hydroxy-2-methyloxan-4-yl]thiophen-2-yl]sulfanyl-1-methylquinolin-2-one is sourced from PubChem (CID 22860812), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).