About 3-[(5E)-5-benzylidene-3,4-dihydro-2H-pyridin-6-yl]pyridine
3-[(5E)-5-benzylidene-3,4-dihydro-2H-pyridin-6-yl]pyridine (PubChem CID 22861093) has the molecular formula C17H16N2
and a molecular weight of 248.33 g/mol. Its IUPAC name is 3-[(5E)-5-benzylidene-3,4-dihydro-2H-pyridin-6-yl]pyridine.
Molecular Properties
| Compound Name | 3-[(5E)-5-benzylidene-3,4-dihydro-2H-pyridin-6-yl]pyridine |
| PubChem CID | 22861093 |
| Molecular Formula | C17H16N2 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | 3-[(5E)-5-benzylidene-3,4-dihydro-2H-pyridin-6-yl]pyridine |
| SMILES | C(=C1\CCCN=C1c1cccnc1)\c1ccccc1 |
| InChI | InChI=1S/C17H16N2/c1-2-6-14(7-3-1)12-15-8-5-11-19-17(15)16-9-4-10-18-13-16/h1-4,6-7,9-10,12-13H,5,8,11H2/b15-12+ |
| InChIKey | KRYNRVPZHUUTOR-NTCAYCPXSA-N |
| XLogP | 3.75 |
| TPSA | 25.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-[(5E)-5-benzylidene-3,4-dihydro-2H-pyridin-6-yl]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(5E)-5-benzylidene-3,4-dihydro-2H-pyridin-6-yl]pyridine?
The IUPAC name of 3-[(5E)-5-benzylidene-3,4-dihydro-2H-pyridin-6-yl]pyridine (CID 22861093) is 3-[(5E)-5-benzylidene-3,4-dihydro-2H-pyridin-6-yl]pyridine.
What is the SMILES notation for 3-[(5E)-5-benzylidene-3,4-dihydro-2H-pyridin-6-yl]pyridine?
The canonical SMILES for 3-[(5E)-5-benzylidene-3,4-dihydro-2H-pyridin-6-yl]pyridine is C(=C1\CCCN=C1c1cccnc1)\c1ccccc1.
What is the InChIKey of 3-[(5E)-5-benzylidene-3,4-dihydro-2H-pyridin-6-yl]pyridine?
The InChIKey is KRYNRVPZHUUTOR-NTCAYCPXSA-N. The full InChI is InChI=1S/C17H16N2/c1-2-6-14(7-3-1)12-15-8-5-11-19-17(15)16-9-4-10-18-13-16/h1-4,6-7,9-10,12-13H,5,8,11H2/b15-12+.
What are the key properties of 3-[(5E)-5-benzylidene-3,4-dihydro-2H-pyridin-6-yl]pyridine?
3-[(5E)-5-benzylidene-3,4-dihydro-2H-pyridin-6-yl]pyridine has a molecular weight of 248.33 g/mol, XLogP of 3.75, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(5E)-5-benzylidene-3,4-dihydro-2H-pyridin-6-yl]pyridine is sourced from PubChem (CID 22861093), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).