C26H31NO8 — CID 22861306
benzyl N-[4-[[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methoxy]phenyl]carbamate (PubChem CID 22861306) has the molecular formula C26H31NO8 and a molecular weight of 485.53 g/mol. Its IUPAC name is benzyl N-[4-[[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methoxy]phenyl]carbamate.
| Compound Name | benzyl N-[4-[[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methoxy]phenyl]carbamate |
|---|---|
| PubChem CID | 22861306 |
| Molecular Formula | C26H31NO8 |
| Molecular Weight | 485.53 g/mol |
| Exact Mass | 485.20 |
| IUPAC Name | benzyl N-[4-[[(1S,2R,6R,8R,9S)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methoxy]phenyl]carbamate |
| SMILES | CC1(C)O[C@H]2[C@@H](O1)[C@@H](COc1ccc(NC(=O)OCc3ccccc3)cc1)O[C@@H]1OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C26H31NO8/c1-25(2)32-20-19(31-23-22(21(20)33-25)34-26(3,4)35-23)15-29-18-12-10-17(11-13-18)27-24(28)30-14-16-8-6-5-7-9-16/h5-13,19-23H,14-15H2,1-4H3,(H,27,28)/t19-,20+,21+,22-,23-/m1/s1 |
| InChIKey | NFEVFPCYMFLOOT-BMXMUORJSA-N |
| XLogP | 4.21 |
| TPSA | 93.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.53 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |