C22H24N4O3 — CID 22861395
3-[2-[(3aR,9bR)-6-methoxy-2,3,3a,4,5,9b-hexahydro-1H-benzo[g]isoindol-1-yl]ethyl]-1H-pyrido[3,4-d]pyrimidine-2,4-dione (PubChem CID 22861395) has the molecular formula C22H24N4O3 and a molecular weight of 392.46 g/mol. Its IUPAC name is 3-[2-[(3aR,9bR)-6-methoxy-2,3,3a,4,5,9b-hexahydro-1H-benzo[g]isoindol-1-yl]ethyl]-1H-pyrido[3,4-d]pyrimidine-2,4-dione.
| Compound Name | 3-[2-[(3aR,9bR)-6-methoxy-2,3,3a,4,5,9b-hexahydro-1H-benzo[g]isoindol-1-yl]ethyl]-1H-pyrido[3,4-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 22861395 |
| Molecular Formula | C22H24N4O3 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | 3-[2-[(3aR,9bR)-6-methoxy-2,3,3a,4,5,9b-hexahydro-1H-benzo[g]isoindol-1-yl]ethyl]-1H-pyrido[3,4-d]pyrimidine-2,4-dione |
| SMILES | COc1cccc2c1CC[C@H]1CNC(CCn3c(=O)[nH]c4cnccc4c3=O)[C@@H]21 |
| InChI | InChI=1S/C22H24N4O3/c1-29-19-4-2-3-15-14(19)6-5-13-11-24-17(20(13)15)8-10-26-21(27)16-7-9-23-12-18(16)25-22(26)28/h2-4,7,9,12-13,17,20,24H,5-6,8,10-11H2,1H3,(H,25,28)/t13-,17?,20+/m0/s1 |
| InChIKey | BKGVKMKNRSADAX-DOPOYZHKSA-N |
| XLogP | 1.80 |
| TPSA | 89.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |