C33H37BrClN5O4 — CID 22861431
4-[4-[4-[4-[[(2R,4R)-2-(bromomethyl)-2-(4-chlorophenyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]phenyl]-2-butan-2-yl-1,2,4-triazol-3-one (PubChem CID 22861431) has the molecular formula C33H37BrClN5O4 and a molecular weight of 683.05 g/mol. Its IUPAC name is 4-[4-[4-[4-[[(2R,4R)-2-(bromomethyl)-2-(4-chlorophenyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]phenyl]-2-butan-2-yl-1,2,4-triazol-3-one.
| Compound Name | 4-[4-[4-[4-[[(2R,4R)-2-(bromomethyl)-2-(4-chlorophenyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]phenyl]-2-butan-2-yl-1,2,4-triazol-3-one |
|---|---|
| PubChem CID | 22861431 |
| Molecular Formula | C33H37BrClN5O4 |
| Molecular Weight | 683.05 g/mol |
| Exact Mass | 681.17 |
| IUPAC Name | 4-[4-[4-[4-[[(2R,4R)-2-(bromomethyl)-2-(4-chlorophenyl)-1,3-dioxolan-4-yl]methoxy]phenyl]piperazin-1-yl]phenyl]-2-butan-2-yl-1,2,4-triazol-3-one |
| SMILES | CCC(C)n1ncn(-c2ccc(N3CCN(c4ccc(OC[C@@H]5CO[C@](CBr)(c6ccc(Cl)cc6)O5)cc4)CC3)cc2)c1=O |
| InChI | InChI=1S/C33H37BrClN5O4/c1-3-24(2)40-32(41)39(23-36-40)29-10-8-27(9-11-29)37-16-18-38(19-17-37)28-12-14-30(15-13-28)42-20-31-21-43-33(22-34,44-31)25-4-6-26(35)7-5-25/h4-15,23-24,31H,3,16-22H2,1-2H3/t24?,31-,33+/m1/s1 |
| InChIKey | KYQGOLADTZTQAY-HJWSHEATSA-N |
| XLogP | 6.03 |
| TPSA | 73.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.05 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|