C36H34N4O5 — CID 22861884
1-benzyl-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(trityloxymethyl)oxolan-2-yl]-2,3-dihydropurin-6-one (PubChem CID 22861884) has the molecular formula C36H34N4O5 and a molecular weight of 602.69 g/mol. Its IUPAC name is 1-benzyl-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(trityloxymethyl)oxolan-2-yl]-2,3-dihydropurin-6-one.
| Compound Name | 1-benzyl-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(trityloxymethyl)oxolan-2-yl]-2,3-dihydropurin-6-one |
|---|---|
| PubChem CID | 22861884 |
| Molecular Formula | C36H34N4O5 |
| Molecular Weight | 602.69 g/mol |
| Exact Mass | 602.25 |
| IUPAC Name | 1-benzyl-9-[(2R,3R,4S,5R)-3,4-dihydroxy-5-(trityloxymethyl)oxolan-2-yl]-2,3-dihydropurin-6-one |
| SMILES | O=C1c2ncn([C@@H]3O[C@H](COC(c4ccccc4)(c4ccccc4)c4ccccc4)[C@@H](O)[C@H]3O)c2NCN1Cc1ccccc1 |
| InChI | InChI=1S/C36H34N4O5/c41-31-29(22-44-36(26-15-7-2-8-16-26,27-17-9-3-10-18-27)28-19-11-4-12-20-28)45-35(32(31)42)40-24-37-30-33(40)38-23-39(34(30)43)21-25-13-5-1-6-14-25/h1-20,24,29,31-32,35,38,41-42H,21-23H2/t29-,31-,32-,35-/m1/s1 |
| InChIKey | LJUFPSGUCLTODI-QSYCCZFCSA-N |
| XLogP | 4.54 |
| TPSA | 109.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.69 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|