C55H48N4O5 — CID 22861885
1-benzyl-9-[(2R,3R,4R,5R)-4-hydroxy-3-trityloxy-5-(trityloxymethyl)oxolan-2-yl]-6H-purin-6-ol (PubChem CID 22861885) has the molecular formula C55H48N4O5 and a molecular weight of 845.01 g/mol. Its IUPAC name is 1-benzyl-9-[(2R,3R,4R,5R)-4-hydroxy-3-trityloxy-5-(trityloxymethyl)oxolan-2-yl]-6H-purin-6-ol.
| Compound Name | 1-benzyl-9-[(2R,3R,4R,5R)-4-hydroxy-3-trityloxy-5-(trityloxymethyl)oxolan-2-yl]-6H-purin-6-ol |
|---|---|
| PubChem CID | 22861885 |
| Molecular Formula | C55H48N4O5 |
| Molecular Weight | 845.01 g/mol |
| Exact Mass | 844.36 |
| IUPAC Name | 1-benzyl-9-[(2R,3R,4R,5R)-4-hydroxy-3-trityloxy-5-(trityloxymethyl)oxolan-2-yl]-6H-purin-6-ol |
| SMILES | OC1c2ncn([C@@H]3O[C@H](COC(c4ccccc4)(c4ccccc4)c4ccccc4)[C@@H](O)[C@H]3OC(c3ccccc3)(c3ccccc3)c3ccccc3)c2N=CN1Cc1ccccc1 |
| InChI | InChI=1S/C55H48N4O5/c60-49-47(37-62-54(41-24-10-2-11-25-41,42-26-12-3-13-27-42)43-28-14-4-15-29-43)63-53(59-39-56-48-51(59)57-38-58(52(48)61)36-40-22-8-1-9-23-40)50(49)64-55(44-30-16-5-17-31-44,45-32-18-6-19-33-45)46-34-20-7-21-35-46/h1-35,38-39,47,49-50,52-53,60-61H,36-37H2/t47-,49-,50-,52?,53-/m1/s1 |
| InChIKey | HSEFTBZERDIZKO-NSIGJYFOSA-N |
| XLogP | 9.69 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 845.01 |
| LogP ≤ 5 | 9.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|