C23H37NO4 — CID 22862111
tert-butyl (4S,5S)-4-[benzyl(methyl)amino]-2-(1-hydroxypropan-2-yl)-5-methyl-3-oxoheptanoate (PubChem CID 22862111) has the molecular formula C23H37NO4 and a molecular weight of 391.55 g/mol. Its IUPAC name is tert-butyl (4S,5S)-4-[benzyl(methyl)amino]-2-(1-hydroxypropan-2-yl)-5-methyl-3-oxoheptanoate.
| Compound Name | tert-butyl (4S,5S)-4-[benzyl(methyl)amino]-2-(1-hydroxypropan-2-yl)-5-methyl-3-oxoheptanoate |
|---|---|
| PubChem CID | 22862111 |
| Molecular Formula | C23H37NO4 |
| Molecular Weight | 391.55 g/mol |
| Exact Mass | 391.27 |
| IUPAC Name | tert-butyl (4S,5S)-4-[benzyl(methyl)amino]-2-(1-hydroxypropan-2-yl)-5-methyl-3-oxoheptanoate |
| SMILES | CC[C@H](C)[C@@H](C(=O)C(C(=O)OC(C)(C)C)C(C)CO)N(C)Cc1ccccc1 |
| InChI | InChI=1S/C23H37NO4/c1-8-16(2)20(24(7)14-18-12-10-9-11-13-18)21(26)19(17(3)15-25)22(27)28-23(4,5)6/h9-13,16-17,19-20,25H,8,14-15H2,1-7H3/t16-,17?,19?,20-/m0/s1 |
| InChIKey | VZNCGUXUNQQCCA-KTLDDFEXSA-N |
| XLogP | 3.69 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.55 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|