C19H17IN2O3 — CID 2286241
(4Z)-4-[(3-ethoxy-4-hydroxyphenyl)methylidene]-2-(4-iodophenyl)-5-methylidenepyrazolidin-3-one (PubChem CID 2286241) has the molecular formula C19H17IN2O3 and a molecular weight of 448.26 g/mol. Its IUPAC name is (4Z)-4-[(3-ethoxy-4-hydroxyphenyl)methylidene]-2-(4-iodophenyl)-5-methylidenepyrazolidin-3-one.
| Compound Name | (4Z)-4-[(3-ethoxy-4-hydroxyphenyl)methylidene]-2-(4-iodophenyl)-5-methylidenepyrazolidin-3-one |
|---|---|
| PubChem CID | 2286241 |
| Molecular Formula | C19H17IN2O3 |
| Molecular Weight | 448.26 g/mol |
| Exact Mass | 448.03 |
| IUPAC Name | (4Z)-4-[(3-ethoxy-4-hydroxyphenyl)methylidene]-2-(4-iodophenyl)-5-methylidenepyrazolidin-3-one |
| SMILES | C=c1[nH]n(-c2ccc(I)cc2)c(=O)/c1=C\c1ccc(O)c(OCC)c1 |
| InChI | InChI=1S/C19H17IN2O3/c1-3-25-18-11-13(4-9-17(18)23)10-16-12(2)21-22(19(16)24)15-7-5-14(20)6-8-15/h4-11,21,23H,2-3H2,1H3/b16-10- |
| InChIKey | RXWDGENWNKHWOC-YBEGLDIGSA-N |
| XLogP | 2.11 |
| TPSA | 67.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.26 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|