About (1S,2R)-1-amino-2-hydroxy-2,3-dihydroindene-1-carboxamide
(1S,2R)-1-amino-2-hydroxy-2,3-dihydroindene-1-carboxamide (PubChem CID 22862755) has the molecular formula C10H12N2O2
and a molecular weight of 192.22 g/mol. Its IUPAC name is (1S,2R)-1-amino-2-hydroxy-2,3-dihydroindene-1-carboxamide.
Molecular Properties
| Compound Name | (1S,2R)-1-amino-2-hydroxy-2,3-dihydroindene-1-carboxamide |
| PubChem CID | 22862755 |
| Molecular Formula | C10H12N2O2 |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.09 |
| IUPAC Name | (1S,2R)-1-amino-2-hydroxy-2,3-dihydroindene-1-carboxamide |
| SMILES | NC(=O)[C@]1(N)c2ccccc2C[C@H]1O |
| InChI | InChI=1S/C10H12N2O2/c11-9(14)10(12)7-4-2-1-3-6(7)5-8(10)13/h1-4,8,13H,5,12H2,(H2,11,14)/t8-,10+/m1/s1 |
| InChIKey | UIDAVEHFWVICAE-SCZZXKLOSA-N |
| XLogP | -0.76 |
| TPSA | 89.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (1S,2R)-1-amino-2-hydroxy-2,3-dihydroindene-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,2R)-1-amino-2-hydroxy-2,3-dihydroindene-1-carboxamide?
The IUPAC name of (1S,2R)-1-amino-2-hydroxy-2,3-dihydroindene-1-carboxamide (CID 22862755) is (1S,2R)-1-amino-2-hydroxy-2,3-dihydroindene-1-carboxamide.
What is the SMILES notation for (1S,2R)-1-amino-2-hydroxy-2,3-dihydroindene-1-carboxamide?
The canonical SMILES for (1S,2R)-1-amino-2-hydroxy-2,3-dihydroindene-1-carboxamide is NC(=O)[C@]1(N)c2ccccc2C[C@H]1O.
What is the InChIKey of (1S,2R)-1-amino-2-hydroxy-2,3-dihydroindene-1-carboxamide?
The InChIKey is UIDAVEHFWVICAE-SCZZXKLOSA-N. The full InChI is InChI=1S/C10H12N2O2/c11-9(14)10(12)7-4-2-1-3-6(7)5-8(10)13/h1-4,8,13H,5,12H2,(H2,11,14)/t8-,10+/m1/s1.
What are the key properties of (1S,2R)-1-amino-2-hydroxy-2,3-dihydroindene-1-carboxamide?
(1S,2R)-1-amino-2-hydroxy-2,3-dihydroindene-1-carboxamide has a molecular weight of 192.22 g/mol, XLogP of -0.76, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,2R)-1-amino-2-hydroxy-2,3-dihydroindene-1-carboxamide is sourced from PubChem (CID 22862755), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).