C14H19NO6 — CID 22863050
(3R,4R,5S,6R)-3-amino-4,5,6,7-tetrahydroxy-1-(2-methylphenyl)heptane-1,2-dione (PubChem CID 22863050) has the molecular formula C14H19NO6 and a molecular weight of 297.31 g/mol. Its IUPAC name is (3R,4R,5S,6R)-3-amino-4,5,6,7-tetrahydroxy-1-(2-methylphenyl)heptane-1,2-dione.
| Compound Name | (3R,4R,5S,6R)-3-amino-4,5,6,7-tetrahydroxy-1-(2-methylphenyl)heptane-1,2-dione |
|---|---|
| PubChem CID | 22863050 |
| Molecular Formula | C14H19NO6 |
| Molecular Weight | 297.31 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | (3R,4R,5S,6R)-3-amino-4,5,6,7-tetrahydroxy-1-(2-methylphenyl)heptane-1,2-dione |
| SMILES | Cc1ccccc1C(=O)C(=O)[C@H](N)[C@@H](O)[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C14H19NO6/c1-7-4-2-3-5-8(7)11(18)13(20)10(15)14(21)12(19)9(17)6-16/h2-5,9-10,12,14,16-17,19,21H,6,15H2,1H3/t9-,10+,12-,14-/m1/s1 |
| InChIKey | AIKRQTDEBUKZAM-IQOUGMIPSA-N |
| XLogP | -1.85 |
| TPSA | 141.08 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.31 |
| LogP ≤ 5 | -1.85 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|