C38H44N6O4S2 — CID 22863120
1,3-thiazol-5-ylmethyl N-[(2S,3S,5S)-3-hydroxy-5-[2-[methyl-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]carbamoyl]-2-phenylhydrazinyl]-1,6-diphenylhexan-2-yl]carbamate (PubChem CID 22863120) has the molecular formula C38H44N6O4S2 and a molecular weight of 712.94 g/mol. Its IUPAC name is 1,3-thiazol-5-ylmethyl N-[(2S,3S,5S)-3-hydroxy-5-[2-[methyl-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]carbamoyl]-2-phenylhydrazinyl]-1,6-diphenylhexan-2-yl]carbamate.
| Compound Name | 1,3-thiazol-5-ylmethyl N-[(2S,3S,5S)-3-hydroxy-5-[2-[methyl-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]carbamoyl]-2-phenylhydrazinyl]-1,6-diphenylhexan-2-yl]carbamate |
|---|---|
| PubChem CID | 22863120 |
| Molecular Formula | C38H44N6O4S2 |
| Molecular Weight | 712.94 g/mol |
| Exact Mass | 712.29 |
| IUPAC Name | 1,3-thiazol-5-ylmethyl N-[(2S,3S,5S)-3-hydroxy-5-[2-[methyl-[(2-propan-2-yl-1,3-thiazol-4-yl)methyl]carbamoyl]-2-phenylhydrazinyl]-1,6-diphenylhexan-2-yl]carbamate |
| SMILES | CC(C)c1nc(CN(C)C(=O)N(N[C@@H](Cc2ccccc2)C[C@H](O)[C@H](Cc2ccccc2)NC(=O)OCc2cncs2)c2ccccc2)cs1 |
| InChI | InChI=1S/C38H44N6O4S2/c1-27(2)36-40-31(25-49-36)23-43(3)38(47)44(32-17-11-6-12-18-32)42-30(19-28-13-7-4-8-14-28)21-35(45)34(20-29-15-9-5-10-16-29)41-37(46)48-24-33-22-39-26-50-33/h4-18,22,25-27,30,34-35,42,45H,19-21,23-24H2,1-3H3,(H,41,46)/t30-,34-,35-/m0/s1 |
| InChIKey | NJFWQCXCINLUFT-RCTKZWLUSA-N |
| XLogP | 7.19 |
| TPSA | 119.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.94 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|