C23H41N3O4 — CID 22863452
tert-butyl N-[6-[[(2S,4R)-1-(2-methylpropyl)-5-oxo-4-prop-2-enylpyrrolidin-2-yl]methylamino]-6-oxohexyl]carbamate (PubChem CID 22863452) has the molecular formula C23H41N3O4 and a molecular weight of 423.60 g/mol. Its IUPAC name is tert-butyl N-[6-[[(2S,4R)-1-(2-methylpropyl)-5-oxo-4-prop-2-enylpyrrolidin-2-yl]methylamino]-6-oxohexyl]carbamate.
| Compound Name | tert-butyl N-[6-[[(2S,4R)-1-(2-methylpropyl)-5-oxo-4-prop-2-enylpyrrolidin-2-yl]methylamino]-6-oxohexyl]carbamate |
|---|---|
| PubChem CID | 22863452 |
| Molecular Formula | C23H41N3O4 |
| Molecular Weight | 423.60 g/mol |
| Exact Mass | 423.31 |
| IUPAC Name | tert-butyl N-[6-[[(2S,4R)-1-(2-methylpropyl)-5-oxo-4-prop-2-enylpyrrolidin-2-yl]methylamino]-6-oxohexyl]carbamate |
| SMILES | C=CC[C@@H]1C[C@@H](CNC(=O)CCCCCNC(=O)OC(C)(C)C)N(CC(C)C)C1=O |
| InChI | InChI=1S/C23H41N3O4/c1-7-11-18-14-19(26(21(18)28)16-17(2)3)15-25-20(27)12-9-8-10-13-24-22(29)30-23(4,5)6/h7,17-19H,1,8-16H2,2-6H3,(H,24,29)(H,25,27)/t18-,19+/m1/s1 |
| InChIKey | WOWICJUOKQESHC-MOPGFXCFSA-N |
| XLogP | 3.64 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.60 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|