C25H39N5O4 — CID 22863943
methyl 2-[(3S,5S)-5-[[7-(diaminomethylideneamino)heptanoylamino]methyl]-2-oxo-1-(3-phenylpropyl)pyrrolidin-3-yl]acetate (PubChem CID 22863943) has the molecular formula C25H39N5O4 and a molecular weight of 473.62 g/mol. Its IUPAC name is methyl 2-[(3S,5S)-5-[[7-(diaminomethylideneamino)heptanoylamino]methyl]-2-oxo-1-(3-phenylpropyl)pyrrolidin-3-yl]acetate.
| Compound Name | methyl 2-[(3S,5S)-5-[[7-(diaminomethylideneamino)heptanoylamino]methyl]-2-oxo-1-(3-phenylpropyl)pyrrolidin-3-yl]acetate |
|---|---|
| PubChem CID | 22863943 |
| Molecular Formula | C25H39N5O4 |
| Molecular Weight | 473.62 g/mol |
| Exact Mass | 473.30 |
| IUPAC Name | methyl 2-[(3S,5S)-5-[[7-(diaminomethylideneamino)heptanoylamino]methyl]-2-oxo-1-(3-phenylpropyl)pyrrolidin-3-yl]acetate |
| SMILES | COC(=O)C[C@@H]1C[C@@H](CNC(=O)CCCCCCN=C(N)N)N(CCCc2ccccc2)C1=O |
| InChI | InChI=1S/C25H39N5O4/c1-34-23(32)17-20-16-21(18-29-22(31)13-7-2-3-8-14-28-25(26)27)30(24(20)33)15-9-12-19-10-5-4-6-11-19/h4-6,10-11,20-21H,2-3,7-9,12-18H2,1H3,(H,29,31)(H4,26,27,28)/t20-,21-/m0/s1 |
| InChIKey | STRRIGSAGYMHAA-SFTDATJTSA-N |
| XLogP | 1.74 |
| TPSA | 140.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.62 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|