C16H25NO2 — CID 22863989
(6R)-3-cyclohexyl-6-methyl-6-prop-2-enyl-1,3,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazol-5-one (PubChem CID 22863989) has the molecular formula C16H25NO2 and a molecular weight of 263.38 g/mol. Its IUPAC name is (6R)-3-cyclohexyl-6-methyl-6-prop-2-enyl-1,3,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazol-5-one.
| Compound Name | (6R)-3-cyclohexyl-6-methyl-6-prop-2-enyl-1,3,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazol-5-one |
|---|---|
| PubChem CID | 22863989 |
| Molecular Formula | C16H25NO2 |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.19 |
| IUPAC Name | (6R)-3-cyclohexyl-6-methyl-6-prop-2-enyl-1,3,7,7a-tetrahydropyrrolo[1,2-c][1,3]oxazol-5-one |
| SMILES | C=CC[C@]1(C)CC2COC(C3CCCCC3)N2C1=O |
| InChI | InChI=1S/C16H25NO2/c1-3-9-16(2)10-13-11-19-14(17(13)15(16)18)12-7-5-4-6-8-12/h3,12-14H,1,4-11H2,2H3/t13?,14?,16-/m1/s1 |
| InChIKey | PLTVRBNDYFOBTB-ZBCRRDGASA-N |
| XLogP | 3.11 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|