C15H23NO2 — CID 22863990
(6R)-3-cyclohexyl-6-prop-2-enyl-3,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-5-one (PubChem CID 22863990) has the molecular formula C15H23NO2 and a molecular weight of 249.35 g/mol. Its IUPAC name is (6R)-3-cyclohexyl-6-prop-2-enyl-3,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-5-one.
| Compound Name | (6R)-3-cyclohexyl-6-prop-2-enyl-3,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-5-one |
|---|---|
| PubChem CID | 22863990 |
| Molecular Formula | C15H23NO2 |
| Molecular Weight | 249.35 g/mol |
| Exact Mass | 249.17 |
| IUPAC Name | (6R)-3-cyclohexyl-6-prop-2-enyl-3,6,7,7a-tetrahydro-1H-pyrrolo[1,2-c][1,3]oxazol-5-one |
| SMILES | C=CC[C@@H]1CC2COC(C3CCCCC3)N2C1=O |
| InChI | InChI=1S/C15H23NO2/c1-2-6-12-9-13-10-18-15(16(13)14(12)17)11-7-4-3-5-8-11/h2,11-13,15H,1,3-10H2/t12-,13?,15?/m1/s1 |
| InChIKey | FKYUBUQZCREUPV-DNOWBOINSA-N |
| XLogP | 2.72 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.35 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|