C18H18INO4 — CID 22864172
methyl (2E)-2-[2-[(4-iodo-2-methylphenoxy)methyl]phenyl]-2-methoxyiminoacetate (PubChem CID 22864172) has the molecular formula C18H18INO4 and a molecular weight of 439.25 g/mol. Its IUPAC name is methyl (2E)-2-[2-[(4-iodo-2-methylphenoxy)methyl]phenyl]-2-methoxyiminoacetate.
| Compound Name | methyl (2E)-2-[2-[(4-iodo-2-methylphenoxy)methyl]phenyl]-2-methoxyiminoacetate |
|---|---|
| PubChem CID | 22864172 |
| Molecular Formula | C18H18INO4 |
| Molecular Weight | 439.25 g/mol |
| Exact Mass | 439.03 |
| IUPAC Name | methyl (2E)-2-[2-[(4-iodo-2-methylphenoxy)methyl]phenyl]-2-methoxyiminoacetate |
| SMILES | CO/N=C(/C(=O)OC)c1ccccc1COc1ccc(I)cc1C |
| InChI | InChI=1S/C18H18INO4/c1-12-10-14(19)8-9-16(12)24-11-13-6-4-5-7-15(13)17(20-23-3)18(21)22-2/h4-10H,11H2,1-3H3/b20-17+ |
| InChIKey | UZHDQULVDLVGOW-LVZFUZTISA-N |
| XLogP | 3.70 |
| TPSA | 57.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.25 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|