C19H23ClN6O9S3 — CID 22864792
N-[4-[(E)-(3-methyl-5-sulfamoyl-1,3,4-thiadiazol-2-ylidene)amino]sulfonylphenyl]-2-(2,4,6-trimethylpyridin-1-ium-1-yl)acetamide perchlorate (PubChem CID 22864792) has the molecular formula C19H23ClN6O9S3 and a molecular weight of 611.08 g/mol. Its IUPAC name is N-[4-[(E)-(3-methyl-5-sulfamoyl-1,3,4-thiadiazol-2-ylidene)amino]sulfonylphenyl]-2-(2,4,6-trimethylpyridin-1-ium-1-yl)acetamide perchlorate.
| Compound Name | N-[4-[(E)-(3-methyl-5-sulfamoyl-1,3,4-thiadiazol-2-ylidene)amino]sulfonylphenyl]-2-(2,4,6-trimethylpyridin-1-ium-1-yl)acetamide perchlorate |
|---|---|
| PubChem CID | 22864792 |
| Molecular Formula | C19H23ClN6O9S3 |
| Molecular Weight | 611.08 g/mol |
| Exact Mass | 610.04 |
| IUPAC Name | N-[4-[(E)-(3-methyl-5-sulfamoyl-1,3,4-thiadiazol-2-ylidene)amino]sulfonylphenyl]-2-(2,4,6-trimethylpyridin-1-ium-1-yl)acetamide perchlorate |
| SMILES | Cc1cc(C)[n+](CC(=O)Nc2ccc(S(=O)(=O)/N=c3/sc(S(N)(=O)=O)nn3C)cc2)c(C)c1.[O-][Cl+3]([O-])([O-])[O-] |
| InChI | InChI=1S/C19H22N6O5S3.ClHO4/c1-12-9-13(2)25(14(3)10-12)11-17(26)21-15-5-7-16(8-6-15)33(29,30)23-18-24(4)22-19(31-18)32(20,27)28;2-1(3,4)5/h5-10H,11H2,1-4H3,(H2-,20,21,26,27,28);(H,2,3,4,5)/b23-18+; |
| InChIKey | WPJLHTOTIPRDRZ-XHMOQMQQSA-N |
| XLogP | -4.49 |
| TPSA | 249.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.08 |
| LogP ≤ 5 | -4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|