C17H35NO5Si — CID 22864998
tert-butyl (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(1,2-dihydroxyethyl)pyrrolidine-1-carboxylate (PubChem CID 22864998) has the molecular formula C17H35NO5Si and a molecular weight of 361.56 g/mol. Its IUPAC name is tert-butyl (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(1,2-dihydroxyethyl)pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(1,2-dihydroxyethyl)pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 22864998 |
| Molecular Formula | C17H35NO5Si |
| Molecular Weight | 361.56 g/mol |
| Exact Mass | 361.23 |
| IUPAC Name | tert-butyl (2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-2-(1,2-dihydroxyethyl)pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](O[Si](C)(C)C(C)(C)C)C[C@H]1C(O)CO |
| InChI | InChI=1S/C17H35NO5Si/c1-16(2,3)22-15(21)18-10-12(9-13(18)14(20)11-19)23-24(7,8)17(4,5)6/h12-14,19-20H,9-11H2,1-8H3/t12-,13+,14?/m1/s1 |
| InChIKey | ITIKVJQJZVFHBK-AMIUJLCOSA-N |
| XLogP | 2.74 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.56 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|