C15H19NOS — CID 22865074
(4aR,10bR)-4,10b-dimethyl-8-sulfanylidene-1,2,4a,5,6,9-hexahydrobenzo[f]quinolin-3-one (PubChem CID 22865074) has the molecular formula C15H19NOS and a molecular weight of 261.39 g/mol. Its IUPAC name is (4aR,10bR)-4,10b-dimethyl-8-sulfanylidene-1,2,4a,5,6,9-hexahydrobenzo[f]quinolin-3-one.
| Compound Name | (4aR,10bR)-4,10b-dimethyl-8-sulfanylidene-1,2,4a,5,6,9-hexahydrobenzo[f]quinolin-3-one |
|---|---|
| PubChem CID | 22865074 |
| Molecular Formula | C15H19NOS |
| Molecular Weight | 261.39 g/mol |
| Exact Mass | 261.12 |
| IUPAC Name | (4aR,10bR)-4,10b-dimethyl-8-sulfanylidene-1,2,4a,5,6,9-hexahydrobenzo[f]quinolin-3-one |
| SMILES | CN1C(=O)CC[C@]2(C)C3=CCC(=S)C=C3CC[C@@H]12 |
| InChI | InChI=1S/C15H19NOS/c1-15-8-7-14(17)16(2)13(15)6-3-10-9-11(18)4-5-12(10)15/h5,9,13H,3-4,6-8H2,1-2H3/t13-,15-/m1/s1 |
| InChIKey | RXANUKHACGTWNI-UKRRQHHQSA-N |
| XLogP | 3.03 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.39 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|