C5H8O5 — CID 22866451
(3S,4R,5R)-3,4,5-trihydroxyoxan-2-one (PubChem CID 22866451) has the molecular formula C5H8O5 and a molecular weight of 148.11 g/mol. Its IUPAC name is (3S,4R,5R)-3,4,5-trihydroxyoxan-2-one.
| Compound Name | (3S,4R,5R)-3,4,5-trihydroxyoxan-2-one |
|---|---|
| PubChem CID | 22866451 |
| Molecular Formula | C5H8O5 |
| Molecular Weight | 148.11 g/mol |
| Exact Mass | 148.04 |
| IUPAC Name | (3S,4R,5R)-3,4,5-trihydroxyoxan-2-one |
| SMILES | O=C1OC[C@@H](O)[C@@H](O)[C@@H]1O |
| InChI | InChI=1S/C5H8O5/c6-2-1-10-5(9)4(8)3(2)7/h2-4,6-8H,1H2/t2-,3-,4+/m1/s1 |
| InChIKey | XXBSUZSONOQQGK-JJYYJPOSSA-N |
| XLogP | -2.37 |
| TPSA | 86.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.11 |
| LogP ≤ 5 | -2.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |