C15H16F2N2O6 — CID 22866453
4-[[4-(difluoromethoxy)-2-nitrophenyl]methyl]-2,6,6-trimethyloxazinane-3,5-dione (PubChem CID 22866453) has the molecular formula C15H16F2N2O6 and a molecular weight of 358.30 g/mol. Its IUPAC name is 4-[[4-(difluoromethoxy)-2-nitrophenyl]methyl]-2,6,6-trimethyloxazinane-3,5-dione.
| Compound Name | 4-[[4-(difluoromethoxy)-2-nitrophenyl]methyl]-2,6,6-trimethyloxazinane-3,5-dione |
|---|---|
| PubChem CID | 22866453 |
| Molecular Formula | C15H16F2N2O6 |
| Molecular Weight | 358.30 g/mol |
| Exact Mass | 358.10 |
| IUPAC Name | 4-[[4-(difluoromethoxy)-2-nitrophenyl]methyl]-2,6,6-trimethyloxazinane-3,5-dione |
| SMILES | CN1OC(C)(C)C(=O)C(Cc2ccc(OC(F)F)cc2[N+](=O)[O-])C1=O |
| InChI | InChI=1S/C15H16F2N2O6/c1-15(2)12(20)10(13(21)18(3)25-15)6-8-4-5-9(24-14(16)17)7-11(8)19(22)23/h4-5,7,10,14H,6H2,1-3H3 |
| InChIKey | HVSWAAACBINGHQ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 98.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.30 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|