C25H30F2O7Si — CID 22866806
[tert-butyl(dimethyl)silyl] (3S,4R)-3-benzoyl-2,2-difluoro-3,4,5-trihydroxy-6-oxo-6-phenylhexanoate (PubChem CID 22866806) has the molecular formula C25H30F2O7Si and a molecular weight of 508.59 g/mol. Its IUPAC name is [tert-butyl(dimethyl)silyl] (3S,4R)-3-benzoyl-2,2-difluoro-3,4,5-trihydroxy-6-oxo-6-phenylhexanoate.
| Compound Name | [tert-butyl(dimethyl)silyl] (3S,4R)-3-benzoyl-2,2-difluoro-3,4,5-trihydroxy-6-oxo-6-phenylhexanoate |
|---|---|
| PubChem CID | 22866806 |
| Molecular Formula | C25H30F2O7Si |
| Molecular Weight | 508.59 g/mol |
| Exact Mass | 508.17 |
| IUPAC Name | [tert-butyl(dimethyl)silyl] (3S,4R)-3-benzoyl-2,2-difluoro-3,4,5-trihydroxy-6-oxo-6-phenylhexanoate |
| SMILES | CC(C)(C)[Si](C)(C)OC(=O)C(F)(F)[C@@](O)(C(=O)c1ccccc1)[C@H](O)C(O)C(=O)c1ccccc1 |
| InChI | InChI=1S/C25H30F2O7Si/c1-23(2,3)35(4,5)34-22(32)25(26,27)24(33,20(30)17-14-10-7-11-15-17)21(31)19(29)18(28)16-12-8-6-9-13-16/h6-15,19,21,29,31,33H,1-5H3/t19?,21-,24-/m1/s1 |
| InChIKey | MQQQNIBUHBQWAY-JNKRKRSOSA-N |
| XLogP | 3.39 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.59 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|