About (2R,3S)-2,3-bis[(1S)-1-azido-2-phenylethyl]oxirane
(2R,3S)-2,3-bis[(1S)-1-azido-2-phenylethyl]oxirane (PubChem CID 22867509) has the molecular formula C18H18N6O
and a molecular weight of 334.38 g/mol. Its IUPAC name is (2R,3S)-2,3-bis[(1S)-1-azido-2-phenylethyl]oxirane.
Molecular Properties
| Compound Name | (2R,3S)-2,3-bis[(1S)-1-azido-2-phenylethyl]oxirane |
| PubChem CID | 22867509 |
| Molecular Formula | C18H18N6O |
| Molecular Weight | 334.38 g/mol |
| Exact Mass | 334.15 |
| IUPAC Name | (2R,3S)-2,3-bis[(1S)-1-azido-2-phenylethyl]oxirane |
| SMILES | [N-]=[N+]=N[C@@H](Cc1ccccc1)[C@@H]1O[C@@H]1[C@H](Cc1ccccc1)N=[N+]=[N-] |
| InChI | InChI=1S/C18H18N6O/c19-23-21-15(11-13-7-3-1-4-8-13)17-18(25-17)16(22-24-20)12-14-9-5-2-6-10-14/h1-10,15-18H,11-12H2/t15-,16-,17-,18+/m0/s1 |
| InChIKey | DOKOGUIMIUVJTI-XLAORIBOSA-N |
| XLogP | 4.60 |
| TPSA | 110.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 334.38 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze (2R,3S)-2,3-bis[(1S)-1-azido-2-phenylethyl]oxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,3S)-2,3-bis[(1S)-1-azido-2-phenylethyl]oxirane?
The IUPAC name of (2R,3S)-2,3-bis[(1S)-1-azido-2-phenylethyl]oxirane (CID 22867509) is (2R,3S)-2,3-bis[(1S)-1-azido-2-phenylethyl]oxirane.
What is the SMILES notation for (2R,3S)-2,3-bis[(1S)-1-azido-2-phenylethyl]oxirane?
The canonical SMILES for (2R,3S)-2,3-bis[(1S)-1-azido-2-phenylethyl]oxirane is [N-]=[N+]=N[C@@H](Cc1ccccc1)[C@@H]1O[C@@H]1[C@H](Cc1ccccc1)N=[N+]=[N-].
What is the InChIKey of (2R,3S)-2,3-bis[(1S)-1-azido-2-phenylethyl]oxirane?
The InChIKey is DOKOGUIMIUVJTI-XLAORIBOSA-N. The full InChI is InChI=1S/C18H18N6O/c19-23-21-15(11-13-7-3-1-4-8-13)17-18(25-17)16(22-24-20)12-14-9-5-2-6-10-14/h1-10,15-18H,11-12H2/t15-,16-,17-,18+/m0/s1.
What are the key properties of (2R,3S)-2,3-bis[(1S)-1-azido-2-phenylethyl]oxirane?
(2R,3S)-2,3-bis[(1S)-1-azido-2-phenylethyl]oxirane has a molecular weight of 334.38 g/mol, XLogP of 4.60, 8 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,3S)-2,3-bis[(1S)-1-azido-2-phenylethyl]oxirane is sourced from PubChem (CID 22867509), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).